C28H24N8O7 — CID 59434939
N-[2-[(2-cyano-4,6-dinitrophenyl)diazenyl]-5-[2-(1,3-dioxoisoindol-2-yl)ethyl-ethylamino]phenyl]propanamide (PubChem CID 59434939) has the molecular formula C28H24N8O7 and a molecular weight of 584.55 g/mol. Its IUPAC name is N-[2-[(2-cyano-4,6-dinitrophenyl)diazenyl]-5-[2-(1,3-dioxoisoindol-2-yl)ethyl-ethylamino]phenyl]propanamide.
| Compound Name | N-[2-[(2-cyano-4,6-dinitrophenyl)diazenyl]-5-[2-(1,3-dioxoisoindol-2-yl)ethyl-ethylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 59434939 |
| Molecular Formula | C28H24N8O7 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | N-[2-[(2-cyano-4,6-dinitrophenyl)diazenyl]-5-[2-(1,3-dioxoisoindol-2-yl)ethyl-ethylamino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(N(CC)CCN2C(=O)c3ccccc3C2=O)ccc1/N=N/c1c(C#N)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H24N8O7/c1-3-25(37)30-23-14-18(33(4-2)11-12-34-27(38)20-7-5-6-8-21(20)28(34)39)9-10-22(23)31-32-26-17(16-29)13-19(35(40)41)15-24(26)36(42)43/h5-10,13-15H,3-4,11-12H2,1-2H3,(H,30,37)/b32-31+ |
| InChIKey | SOPQSNWTCWRRDO-QNEJGDQOSA-N |
| XLogP | 5.26 |
| TPSA | 204.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|