C33H38N4O9S — CID 59435256
2-[6-amino-4-[5-carboxypentyl-[5-(methoxycarbonylamino)pentyl]sulfamoyl]-3-iminoxanthen-9-yl]benzoic acid (PubChem CID 59435256) has the molecular formula C33H38N4O9S and a molecular weight of 666.75 g/mol. Its IUPAC name is 2-[6-amino-4-[5-carboxypentyl-[5-(methoxycarbonylamino)pentyl]sulfamoyl]-3-iminoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[6-amino-4-[5-carboxypentyl-[5-(methoxycarbonylamino)pentyl]sulfamoyl]-3-iminoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 59435256 |
| Molecular Formula | C33H38N4O9S |
| Molecular Weight | 666.75 g/mol |
| Exact Mass | 666.24 |
| IUPAC Name | 2-[6-amino-4-[5-carboxypentyl-[5-(methoxycarbonylamino)pentyl]sulfamoyl]-3-iminoxanthen-9-yl]benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(N)cc3oc-2c1S(=O)(=O)N(CCCCCNC(=O)OC)CCCCCC(=O)O |
| InChI | InChI=1S/C33H38N4O9S/c1-45-33(42)36-17-7-3-9-19-37(18-8-2-4-12-28(38)39)47(43,44)31-26(35)16-15-25-29(22-10-5-6-11-23(22)32(40)41)24-14-13-21(34)20-27(24)46-30(25)31/h5-6,10-11,13-16,20,35H,2-4,7-9,12,17-19,34H2,1H3,(H,36,42)(H,38,39)(H,40,41)/b35-26+ |
| InChIKey | JGWZAROGIPLBOQ-MDAYZVFASA-N |
| XLogP | 5.13 |
| TPSA | 213.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.75 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|