About 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole
6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole (PubChem CID 59435381) has the molecular formula C14H15N3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole |
| PubChem CID | 59435381 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole |
| SMILES | Cc1ncnc(C)c1-c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C14H15N3/c1-9-14(10(2)17-8-16-9)12-4-3-11-5-6-15-13(11)7-12/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | IUQUWQAPPTYKIY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole?
The IUPAC name of 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole (CID 59435381) is 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole?
The canonical SMILES for 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole is Cc1ncnc(C)c1-c1ccc2c(c1)NCC2.
What is the InChIKey of 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole?
The InChIKey is IUQUWQAPPTYKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3/c1-9-14(10(2)17-8-16-9)12-4-3-11-5-6-15-13(11)7-12/h3-4,7-8,15H,5-6H2,1-2H3.
What are the key properties of 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole?
6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole has a molecular weight of 225.29 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,6-dimethylpyrimidin-5-yl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 59435381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).