C29H48FNO8 — CID 59435752
(1S,2R,5S,7R,8R,9R,11R,13R,14R)-2-ethyl-5-fluoro-1,5,7,9,11,13,15-heptamethyl-8,9-di(propan-2-yloxy)-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 59435752) has the molecular formula C29H48FNO8 and a molecular weight of 557.70 g/mol. Its IUPAC name is (1S,2R,5S,7R,8R,9R,11R,13R,14R)-2-ethyl-5-fluoro-1,5,7,9,11,13,15-heptamethyl-8,9-di(propan-2-yloxy)-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,2R,5S,7R,8R,9R,11R,13R,14R)-2-ethyl-5-fluoro-1,5,7,9,11,13,15-heptamethyl-8,9-di(propan-2-yloxy)-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 59435752 |
| Molecular Formula | C29H48FNO8 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.34 |
| IUPAC Name | (1S,2R,5S,7R,8R,9R,11R,13R,14R)-2-ethyl-5-fluoro-1,5,7,9,11,13,15-heptamethyl-8,9-di(propan-2-yloxy)-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CC[C@H]1OC(=O)[C@@](C)(F)C(=O)[C@H](C)[C@@H](OC(C)C)[C@](C)(OC(C)C)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(C)C(=O)O[C@]12C |
| InChI | InChI=1S/C29H48FNO8/c1-13-20-29(11)22(31(12)26(35)39-29)18(7)21(32)17(6)14-27(9,38-16(4)5)24(36-15(2)3)19(8)23(33)28(10,30)25(34)37-20/h15-20,22,24H,13-14H2,1-12H3/t17-,18+,19+,20-,22-,24-,27-,28+,29-/m1/s1 |
| InChIKey | XEEBSMUSRVHJDE-OOIKVMAPSA-N |
| XLogP | 4.67 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|