About 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene
4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene (PubChem CID 594359) has the molecular formula C9H6F6
and a molecular weight of 228.14 g/mol. Its IUPAC name is 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene.
Molecular Properties
| Compound Name | 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene |
| PubChem CID | 594359 |
| Molecular Formula | C9H6F6 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene |
| SMILES | FC(F)(F)C1(C(F)(F)F)C=CC2C=CC21 |
| InChI | InChI=1S/C9H6F6/c10-8(11,12)7(9(13,14)15)4-3-5-1-2-6(5)7/h1-6H |
| InChIKey | IDDRYYAUVAHKLF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene?
The IUPAC name of 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene (CID 594359) is 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene.
What is the SMILES notation for 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene?
The canonical SMILES for 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene is FC(F)(F)C1(C(F)(F)F)C=CC2C=CC21.
What is the InChIKey of 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene?
The InChIKey is IDDRYYAUVAHKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F6/c10-8(11,12)7(9(13,14)15)4-3-5-1-2-6(5)7/h1-6H.
What are the key properties of 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene?
4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene has a molecular weight of 228.14 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(trifluoromethyl)bicyclo[3.2.0]hepta-2,6-diene is sourced from PubChem (CID 594359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).