C16H9Cl2N5O — CID 59435986
6-[(3,5-dichloro-4-pyridinyl)amino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one (PubChem CID 59435986) has the molecular formula C16H9Cl2N5O and a molecular weight of 358.19 g/mol. Its IUPAC name is 6-[(3,5-dichloro-4-pyridinyl)amino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one.
| Compound Name | 6-[(3,5-dichloro-4-pyridinyl)amino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one |
|---|---|
| PubChem CID | 59435986 |
| Molecular Formula | C16H9Cl2N5O |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 6-[(3,5-dichloro-4-pyridinyl)amino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one |
| SMILES | O=c1[nH]ccc2c(Nc3c(Cl)cncc3Cl)nc3ccncc3c12 |
| InChI | InChI=1S/C16H9Cl2N5O/c17-10-6-20-7-11(18)14(10)23-15-8-1-4-21-16(24)13(8)9-5-19-3-2-12(9)22-15/h1-7H,(H,21,24)(H,20,22,23) |
| InChIKey | VQNQLGQGLJSCSM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|