C18H9Cl2F3N4O — CID 59436001
6-[2,6-dichloro-4-(trifluoromethyl)anilino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one (PubChem CID 59436001) has the molecular formula C18H9Cl2F3N4O and a molecular weight of 425.20 g/mol. Its IUPAC name is 6-[2,6-dichloro-4-(trifluoromethyl)anilino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one.
| Compound Name | 6-[2,6-dichloro-4-(trifluoromethyl)anilino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one |
|---|---|
| PubChem CID | 59436001 |
| Molecular Formula | C18H9Cl2F3N4O |
| Molecular Weight | 425.20 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 6-[2,6-dichloro-4-(trifluoromethyl)anilino]-9H-pyrido[4,3-c][1,6]naphthyridin-10-one |
| SMILES | O=c1[nH]ccc2c(Nc3c(Cl)cc(C(F)(F)F)cc3Cl)nc3ccncc3c12 |
| InChI | InChI=1S/C18H9Cl2F3N4O/c19-11-5-8(18(21,22)23)6-12(20)15(11)27-16-9-1-4-25-17(28)14(9)10-7-24-3-2-13(10)26-16/h1-7H,(H,25,28)(H,26,27) |
| InChIKey | XDVPPCRXMKACCE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.20 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|