C17H9Cl2FN4O — CID 59436062
6-(2,6-dichloro-4-fluoroanilino)-9H-pyrido[4,3-c][1,6]naphthyridin-10-one (PubChem CID 59436062) has the molecular formula C17H9Cl2FN4O and a molecular weight of 375.19 g/mol. Its IUPAC name is 6-(2,6-dichloro-4-fluoroanilino)-9H-pyrido[4,3-c][1,6]naphthyridin-10-one.
| Compound Name | 6-(2,6-dichloro-4-fluoroanilino)-9H-pyrido[4,3-c][1,6]naphthyridin-10-one |
|---|---|
| PubChem CID | 59436062 |
| Molecular Formula | C17H9Cl2FN4O |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 6-(2,6-dichloro-4-fluoroanilino)-9H-pyrido[4,3-c][1,6]naphthyridin-10-one |
| SMILES | O=c1[nH]ccc2c(Nc3c(Cl)cc(F)cc3Cl)nc3ccncc3c12 |
| InChI | InChI=1S/C17H9Cl2FN4O/c18-11-5-8(20)6-12(19)15(11)24-16-9-1-4-22-17(25)14(9)10-7-21-3-2-13(10)23-16/h1-7H,(H,22,25)(H,23,24) |
| InChIKey | CODIBUDSZRMNBU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|