C17H15F2N3O5 — CID 59436220
1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-[(E)-3-(dimethylamino)prop-2-enoyl]-5-methoxypyridazin-4-one (PubChem CID 59436220) has the molecular formula C17H15F2N3O5 and a molecular weight of 379.32 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-[(E)-3-(dimethylamino)prop-2-enoyl]-5-methoxypyridazin-4-one.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-[(E)-3-(dimethylamino)prop-2-enoyl]-5-methoxypyridazin-4-one |
|---|---|
| PubChem CID | 59436220 |
| Molecular Formula | C17H15F2N3O5 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-[(E)-3-(dimethylamino)prop-2-enoyl]-5-methoxypyridazin-4-one |
| SMILES | COc1cn(-c2cccc3c2OC(F)(F)O3)nc(C(=O)/C=C/N(C)C)c1=O |
| InChI | InChI=1S/C17H15F2N3O5/c1-21(2)8-7-11(23)14-15(24)13(25-3)9-22(20-14)10-5-4-6-12-16(10)27-17(18,19)26-12/h4-9H,1-3H3/b8-7+ |
| InChIKey | XXOKNSUPFSESCA-BQYQJAHWSA-N |
| XLogP | 1.82 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|