About (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide
(2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide (PubChem CID 59436448) has the molecular formula C9H10F2N4O
and a molecular weight of 228.20 g/mol. Its IUPAC name is (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide |
| PubChem CID | 59436448 |
| Molecular Formula | C9H10F2N4O |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cnccn1)[C@@H]1CC(F)(F)CN1 |
| InChI | InChI=1S/C9H10F2N4O/c10-9(11)3-6(14-5-9)8(16)15-7-4-12-1-2-13-7/h1-2,4,6,14H,3,5H2,(H,13,15,16)/t6-/m0/s1 |
| InChIKey | JJWQEMRESPTGFT-LURJTMIESA-N |
| XLogP | 0.41 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide?
The IUPAC name of (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide (CID 59436448) is (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide is O=C(Nc1cnccn1)[C@@H]1CC(F)(F)CN1.
What is the InChIKey of (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide?
The InChIKey is JJWQEMRESPTGFT-LURJTMIESA-N. The full InChI is InChI=1S/C9H10F2N4O/c10-9(11)3-6(14-5-9)8(16)15-7-4-12-1-2-13-7/h1-2,4,6,14H,3,5H2,(H,13,15,16)/t6-/m0/s1.
What are the key properties of (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide?
(2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide has a molecular weight of 228.20 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4-difluoro-N-pyrazin-2-ylpyrrolidine-2-carboxamide is sourced from PubChem (CID 59436448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).