C10H6ClF2N3O2S — CID 59436556
5-chloro-2,4-difluoro-N-pyridazin-3-ylbenzenesulfonamide (PubChem CID 59436556) has the molecular formula C10H6ClF2N3O2S and a molecular weight of 305.69 g/mol. Its IUPAC name is 5-chloro-2,4-difluoro-N-pyridazin-3-ylbenzenesulfonamide.
| Compound Name | 5-chloro-2,4-difluoro-N-pyridazin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 59436556 |
| Molecular Formula | C10H6ClF2N3O2S |
| Molecular Weight | 305.69 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 5-chloro-2,4-difluoro-N-pyridazin-3-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccnn1)c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C10H6ClF2N3O2S/c11-6-4-9(8(13)5-7(6)12)19(17,18)16-10-2-1-3-14-15-10/h1-5H,(H,15,16) |
| InChIKey | QIMKEDIDTYLFPT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|