C15H20N2 — CID 59436669
6-tert-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 59436669) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 6-tert-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-tert-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 59436669 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 6-tert-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CC(C)(C)c1ccc2[nH]c3c(c2c1)CCNC3 |
| InChI | InChI=1S/C15H20N2/c1-15(2,3)10-4-5-13-12(8-10)11-6-7-16-9-14(11)17-13/h4-5,8,16-17H,6-7,9H2,1-3H3 |
| InChIKey | SFHFVVHKZWPSDX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|