C10H14N2 — CID 59437026
3,7-dimethyl-6,8-dihydro-5H-1,7-naphthyridine (PubChem CID 59437026) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3,7-dimethyl-6,8-dihydro-5H-1,7-naphthyridine.
| Compound Name | 3,7-dimethyl-6,8-dihydro-5H-1,7-naphthyridine |
|---|---|
| PubChem CID | 59437026 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3,7-dimethyl-6,8-dihydro-5H-1,7-naphthyridine |
| SMILES | Cc1cnc2c(c1)CCN(C)C2 |
| InChI | InChI=1S/C10H14N2/c1-8-5-9-3-4-12(2)7-10(9)11-6-8/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | LSLOINQGXWOUDJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |