About N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine
N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine (PubChem CID 59437109) has the molecular formula C12H15N3S
and a molecular weight of 233.33 g/mol. Its IUPAC name is N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine |
| PubChem CID | 59437109 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylethanimidamide |
| SMILES | CC(=NC1=NC2=CC=CC=C2SC1)N(C)C |
| InChI | InChI=1S/C12H15N3S/c1-9(15(2)3)13-12-8-16-11-7-5-4-6-10(11)14-12/h4-7H,8H2,1-3H3 |
| InChIKey | SBPVCODJGTXCKL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 309 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine?
The IUPAC name of N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine (CID 59437109) is N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine?
The canonical SMILES for N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine is CC(=NC1=NC2=CC=CC=C2SC1)N(C)C.
What is the InChIKey of N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine?
The InChIKey is SBPVCODJGTXCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c1-9(15(2)3)13-12-8-16-11-7-5-4-6-10(11)14-12/h4-7H,8H2,1-3H3.
What are the key properties of N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine?
N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine has a molecular weight of 233.33 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2H-1,4-benzothiazin-3-yl)-N,N-dimethylacetamidine is sourced from PubChem (CID 59437109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).