C25H19F4N5O2 — CID 59437229
N-(cyanomethyl)-1-prop-2-enyl-4-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrrole-2-carboxamide (PubChem CID 59437229) has the molecular formula C25H19F4N5O2 and a molecular weight of 497.45 g/mol. Its IUPAC name is N-(cyanomethyl)-1-prop-2-enyl-4-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrrole-2-carboxamide.
| Compound Name | N-(cyanomethyl)-1-prop-2-enyl-4-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59437229 |
| Molecular Formula | C25H19F4N5O2 |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N-(cyanomethyl)-1-prop-2-enyl-4-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrrole-2-carboxamide |
| SMILES | C=CCn1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)cc1C(=O)NCC#N |
| InChI | InChI=1S/C25H19F4N5O2/c1-2-11-33-15-18(13-22(33)23(35)31-10-9-30)24(36,25(27,28)29)17-3-8-21-16(12-17)14-32-34(21)20-6-4-19(26)5-7-20/h2-8,12-15,36H,1,10-11H2,(H,31,35) |
| InChIKey | RTLNUSCOGCDGMC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|