About N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine
N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine (PubChem CID 59437304) has the molecular formula C22H17F4N3
and a molecular weight of 399.39 g/mol. Its IUPAC name is N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine |
| PubChem CID | 59437304 |
| Molecular Formula | C22H17F4N3 |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine |
| SMILES | Fc1ccc(-n2ncc3cc(C(NCc4ccccc4)C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C22H17F4N3/c23-18-7-9-19(10-8-18)29-20-11-6-16(12-17(20)14-28-29)21(22(24,25)26)27-13-15-4-2-1-3-5-15/h1-12,14,21,27H,13H2 |
| InChIKey | LRHPXSMECQUFSZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine?
The IUPAC name of N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine (CID 59437304) is N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine.
What is the SMILES notation for N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine?
The canonical SMILES for N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine is Fc1ccc(-n2ncc3cc(C(NCc4ccccc4)C(F)(F)F)ccc32)cc1.
What is the InChIKey of N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine?
The InChIKey is LRHPXSMECQUFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F4N3/c23-18-7-9-19(10-8-18)29-20-11-6-16(12-17(20)14-28-29)21(22(24,25)26)27-13-15-4-2-1-3-5-15/h1-12,14,21,27H,13H2.
What are the key properties of N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine?
N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine has a molecular weight of 399.39 g/mol, XLogP of 5.56, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanamine is sourced from PubChem (CID 59437304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).