C20H16F3N3O — CID 59437315
2,2,2-trifluoro-1-(1H-indazol-5-yl)-1-(1-prop-2-enylindol-3-yl)ethanol (PubChem CID 59437315) has the molecular formula C20H16F3N3O and a molecular weight of 371.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1H-indazol-5-yl)-1-(1-prop-2-enylindol-3-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(1H-indazol-5-yl)-1-(1-prop-2-enylindol-3-yl)ethanol |
|---|---|
| PubChem CID | 59437315 |
| Molecular Formula | C20H16F3N3O |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2,2,2-trifluoro-1-(1H-indazol-5-yl)-1-(1-prop-2-enylindol-3-yl)ethanol |
| SMILES | C=CCn1cc(C(O)(c2ccc3[nH]ncc3c2)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C20H16F3N3O/c1-2-9-26-12-16(15-5-3-4-6-18(15)26)19(27,20(21,22)23)14-7-8-17-13(10-14)11-24-25-17/h2-8,10-12,27H,1,9H2,(H,24,25) |
| InChIKey | YBERQQZBGAMDRQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|