C24H31N7 — CID 59438219
2-[4-[(5-methyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-3-piperidin-1-ylpyrazine (PubChem CID 59438219) has the molecular formula C24H31N7 and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[4-[(5-methyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-3-piperidin-1-ylpyrazine.
| Compound Name | 2-[4-[(5-methyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-3-piperidin-1-ylpyrazine |
|---|---|
| PubChem CID | 59438219 |
| Molecular Formula | C24H31N7 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 2-[4-[(5-methyl-1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]-3-piperidin-1-ylpyrazine |
| SMILES | Cc1c(CN2CCN(c3nccnc3N3CCCCC3)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C24H31N7/c1-20-21(18-27-31(20)22-8-4-2-5-9-22)19-28-14-16-30(17-15-28)24-23(25-10-11-26-24)29-12-6-3-7-13-29/h2,4-5,8-11,18H,3,6-7,12-17,19H2,1H3 |
| InChIKey | GJJWGPDPKJZHGD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |