About 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol
1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol (PubChem CID 59438239) has the molecular formula C19H29N7O
and a molecular weight of 371.49 g/mol. Its IUPAC name is 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol |
| PubChem CID | 59438239 |
| Molecular Formula | C19H29N7O |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol |
| SMILES | Cc1c(CN2CCN(c3nccnc3N3CCC(O)CC3)CC2)cnn1C |
| InChI | InChI=1S/C19H29N7O/c1-15-16(13-22-23(15)2)14-24-9-11-26(12-10-24)19-18(20-5-6-21-19)25-7-3-17(27)4-8-25/h5-6,13,17,27H,3-4,7-12,14H2,1-2H3 |
| InChIKey | CUUGLDZDBHQLDM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol?
The IUPAC name of 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol (CID 59438239) is 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol.
What is the SMILES notation for 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol?
The canonical SMILES for 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol is Cc1c(CN2CCN(c3nccnc3N3CCC(O)CC3)CC2)cnn1C.
What is the InChIKey of 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol?
The InChIKey is CUUGLDZDBHQLDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N7O/c1-15-16(13-22-23(15)2)14-24-9-11-26(12-10-24)19-18(20-5-6-21-19)25-7-3-17(27)4-8-25/h5-6,13,17,27H,3-4,7-12,14H2,1-2H3.
What are the key properties of 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol?
1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol has a molecular weight of 371.49 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazin-2-yl]piperidin-4-ol is sourced from PubChem (CID 59438239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).