C21H23F3N2O — CID 59438436
2-methyl-N-(1-methyl-3-phenylpiperidin-3-yl)-4-(trifluoromethyl)benzamide (PubChem CID 59438436) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-methyl-N-(1-methyl-3-phenylpiperidin-3-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | 2-methyl-N-(1-methyl-3-phenylpiperidin-3-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 59438436 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-methyl-N-(1-methyl-3-phenylpiperidin-3-yl)-4-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(=O)NC1(c2ccccc2)CCCN(C)C1 |
| InChI | InChI=1S/C21H23F3N2O/c1-15-13-17(21(22,23)24)9-10-18(15)19(27)25-20(11-6-12-26(2)14-20)16-7-4-3-5-8-16/h3-5,7-10,13H,6,11-12,14H2,1-2H3,(H,25,27) |
| InChIKey | LFYCGQDNDXHJED-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |