C25H31FN2O2 — CID 59438599
tert-butyl (7aS)-2-benzyl-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 59438599) has the molecular formula C25H31FN2O2 and a molecular weight of 410.53 g/mol. Its IUPAC name is tert-butyl (7aS)-2-benzyl-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (7aS)-2-benzyl-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 59438599 |
| Molecular Formula | C25H31FN2O2 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | tert-butyl (7aS)-2-benzyl-4-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2CN(Cc3ccccc3)CC2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H31FN2O2/c1-25(2,3)30-24(29)28-14-13-20-16-27(15-18-7-5-4-6-8-18)17-22(20)23(28)19-9-11-21(26)12-10-19/h4-12,20,22-23H,13-17H2,1-3H3/t20-,22?,23?/m1/s1 |
| InChIKey | SDNRGKDWYCGAAT-RDABAPPSSA-N |
| XLogP | 5.26 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |