C15H22N4O4 — CID 59438753
tert-butyl N-[(2R)-1-(2-acetylhydrazinyl)-1-oxo-3-pyridin-3-ylpropan-2-yl]carbamate (PubChem CID 59438753) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(2-acetylhydrazinyl)-1-oxo-3-pyridin-3-ylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(2-acetylhydrazinyl)-1-oxo-3-pyridin-3-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 59438753 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | tert-butyl N-[(2R)-1-(2-acetylhydrazinyl)-1-oxo-3-pyridin-3-ylpropan-2-yl]carbamate |
| SMILES | CC(=O)NNC(=O)[C@@H](Cc1cccnc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N4O4/c1-10(20)18-19-13(21)12(8-11-6-5-7-16-9-11)17-14(22)23-15(2,3)4/h5-7,9,12H,8H2,1-4H3,(H,17,22)(H,18,20)(H,19,21)/t12-/m1/s1 |
| InChIKey | KJDQXYIDPNZLBY-GFCCVEGCSA-N |
| XLogP | 0.68 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|