About tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate
tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate (PubChem CID 59438763) has the molecular formula C10H14F3N3O3
and a molecular weight of 281.23 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate |
| PubChem CID | 59438763 |
| Molecular Formula | C10H14F3N3O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1nnc(C(F)(F)F)o1 |
| InChI | InChI=1S/C10H14F3N3O3/c1-5(14-8(17)19-9(2,3)4)6-15-16-7(18-6)10(11,12)13/h5H,1-4H3,(H,14,17)/t5-/m1/s1 |
| InChIKey | ADXAQRFULSWLMJ-RXMQYKEDSA-N |
| XLogP | 2.67 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate?
The IUPAC name of tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate (CID 59438763) is tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate is C[C@@H](NC(=O)OC(C)(C)C)c1nnc(C(F)(F)F)o1.
What is the InChIKey of tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate?
The InChIKey is ADXAQRFULSWLMJ-RXMQYKEDSA-N. The full InChI is InChI=1S/C10H14F3N3O3/c1-5(14-8(17)19-9(2,3)4)6-15-16-7(18-6)10(11,12)13/h5H,1-4H3,(H,14,17)/t5-/m1/s1.
What are the key properties of tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate?
tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate has a molecular weight of 281.23 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R)-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]ethyl]carbamate is sourced from PubChem (CID 59438763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).