C15H13BrF8O2S — CID 59438866
1-[2-bromo-2-(3,3,3-trifluoropropylsulfonyl)but-3-enyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 59438866) has the molecular formula C15H13BrF8O2S and a molecular weight of 489.22 g/mol. Its IUPAC name is 1-[2-bromo-2-(3,3,3-trifluoropropylsulfonyl)but-3-enyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-[2-bromo-2-(3,3,3-trifluoropropylsulfonyl)but-3-enyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 59438866 |
| Molecular Formula | C15H13BrF8O2S |
| Molecular Weight | 489.22 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 1-[2-bromo-2-(3,3,3-trifluoropropylsulfonyl)but-3-enyl]-4-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | C=CC(Br)(Cc1ccc(C(F)(F)C(F)(F)F)cc1)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C15H13BrF8O2S/c1-2-12(16,27(25,26)8-7-13(17,18)19)9-10-3-5-11(6-4-10)14(20,21)15(22,23)24/h2-6H,1,7-9H2 |
| InChIKey | BCQWKQFJHZBCCX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.22 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|