C27H42N2O5 — CID 59439218
[(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(piperidine-4-carbonyl)carbamate (PubChem CID 59439218) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(piperidine-4-carbonyl)carbamate.
| Compound Name | [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(piperidine-4-carbonyl)carbamate |
|---|---|
| PubChem CID | 59439218 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | [(2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(piperidine-4-carbonyl)carbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)NC(=O)C2CCNCC2)[C@@]2(C)C3C(=O)CCC3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H42N2O5/c1-6-25(4)15-20(34-24(33)29-23(32)18-9-13-28-14-10-18)26(5)16(2)7-11-27(17(3)22(25)31)12-8-19(30)21(26)27/h6,16-18,20-22,28,31H,1,7-15H2,2-5H3,(H,29,32,33)/t16-,17+,20-,21?,22+,25-,26+,27?/m1/s1 |
| InChIKey | WRAIOSGJBVFFEF-PTHVRNICSA-N |
| XLogP | 3.60 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|