C23H39FO5 — CID 59439225
(2R,4R,7R,9R,14R)-4-(2-fluoroethoxy)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 59439225) has the molecular formula C23H39FO5 and a molecular weight of 414.56 g/mol. Its IUPAC name is (2R,4R,7R,9R,14R)-4-(2-fluoroethoxy)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,7R,9R,14R)-4-(2-fluoroethoxy)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 59439225 |
| Molecular Formula | C23H39FO5 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | (2R,4R,7R,9R,14R)-4-(2-fluoroethoxy)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | COCOC1C[C@@](C)(OCCF)C(=O)[C@H](C)C23CCC(OC)C2[C@@]1(C)[C@H](C)CC3 |
| InChI | InChI=1S/C23H39FO5/c1-15-7-9-23-10-8-17(27-6)19(23)22(15,4)18(28-14-26-5)13-21(3,29-12-11-24)20(25)16(23)2/h15-19H,7-14H2,1-6H3/t15-,16+,17?,18?,19?,21-,22+,23?/m1/s1 |
| InChIKey | GNWHMWDRJNRZAY-NTLLXGQHSA-N |
| XLogP | 4.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|