C23H40O3S — CID 59439227
(2R,4R,6R,7R,9R,14R)-4-butylsulfanyl-6-hydroxy-9-methoxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 59439227) has the molecular formula C23H40O3S and a molecular weight of 396.64 g/mol. Its IUPAC name is (2R,4R,6R,7R,9R,14R)-4-butylsulfanyl-6-hydroxy-9-methoxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,6R,7R,9R,14R)-4-butylsulfanyl-6-hydroxy-9-methoxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 59439227 |
| Molecular Formula | C23H40O3S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (2R,4R,6R,7R,9R,14R)-4-butylsulfanyl-6-hydroxy-9-methoxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | CCCCS[C@]1(C)C[C@@H](O)[C@@]2(C)C3C(OC)CCC3(CC[C@H]2C)[C@@H](C)C1=O |
| InChI | InChI=1S/C23H40O3S/c1-7-8-13-27-21(4)14-18(24)22(5)15(2)9-11-23(16(3)20(21)25)12-10-17(26-6)19(22)23/h15-19,24H,7-14H2,1-6H3/t15-,16+,17?,18-,19?,21-,22+,23?/m1/s1 |
| InChIKey | QZNPOIKZIDEAGJ-QOVFQUITSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|