C26H39NO4S — CID 59439283
(2R,4R,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-4-pyridin-2-ylsulfanyltricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 59439283) has the molecular formula C26H39NO4S and a molecular weight of 461.67 g/mol. Its IUPAC name is (2R,4R,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-4-pyridin-2-ylsulfanyltricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-4-pyridin-2-ylsulfanyltricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 59439283 |
| Molecular Formula | C26H39NO4S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | (2R,4R,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-4-pyridin-2-ylsulfanyltricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | COCOC1C[C@@](C)(Sc2ccccn2)C(=O)[C@H](C)C23CCC(OC)C2[C@@]1(C)[C@H](C)CC3 |
| InChI | InChI=1S/C26H39NO4S/c1-17-10-12-26-13-11-19(30-6)22(26)25(17,4)20(31-16-29-5)15-24(3,23(28)18(26)2)32-21-9-7-8-14-27-21/h7-9,14,17-20,22H,10-13,15-16H2,1-6H3/t17-,18+,19?,20?,22?,24-,25+,26?/m1/s1 |
| InChIKey | FZMZXGOIFCHRJQ-YFDSQHOCSA-N |
| XLogP | 5.38 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|