C25H35NO4 — CID 59439390
(1S,2S,14R,15R,16R)-16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol (PubChem CID 59439390) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is (1S,2S,14R,15R,16R)-16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol.
| Compound Name | (1S,2S,14R,15R,16R)-16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
|---|---|
| PubChem CID | 59439390 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (1S,2S,14R,15R,16R)-16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
| SMILES | CO[C@]12CC[C@@]3(C[C@@H]1C(C)(O)C(C)(C)C)C1Cc4ccc(O)c5c4[C@@]3(CCN1)[C@H]2O5 |
| InChI | InChI=1S/C25H35NO4/c1-21(2,3)22(4,28)16-13-23-8-9-25(16,29-5)20-24(23)10-11-26-17(23)12-14-6-7-15(27)19(30-20)18(14)24/h6-7,16-17,20,26-28H,8-13H2,1-5H3/t16-,17?,20-,22?,23-,24+,25-/m1/s1 |
| InChIKey | YOYLLRBMGQRFTN-GBLBCCIMSA-N |
| XLogP | 3.29 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |