About 2-methylquinolin-6-ol
2-methylquinolin-6-ol (PubChem CID 594395) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-methylquinolin-6-ol.
Molecular Properties
| Compound Name | 2-methylquinolin-6-ol |
| PubChem CID | 594395 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2-methylquinolin-6-ol |
| SMILES | Cc1ccc2cc(O)ccc2n1 |
| InChI | InChI=1S/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
| InChIKey | USSQQASIZNTRAJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylquinolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinolin-6-ol?
The IUPAC name of 2-methylquinolin-6-ol (CID 594395) is 2-methylquinolin-6-ol.
What is the SMILES notation for 2-methylquinolin-6-ol?
The canonical SMILES for 2-methylquinolin-6-ol is Cc1ccc2cc(O)ccc2n1.
What is the InChIKey of 2-methylquinolin-6-ol?
The InChIKey is USSQQASIZNTRAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3.
What are the key properties of 2-methylquinolin-6-ol?
2-methylquinolin-6-ol has a molecular weight of 159.19 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinolin-6-ol is sourced from PubChem (CID 594395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).