C36H22N7S+ — CID 59439659
2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenyl-7H-purin-9-ium-8-yl)phenyl]-1,3-benzothiazole (PubChem CID 59439659) has the molecular formula C36H22N7S+ and a molecular weight of 584.69 g/mol. Its IUPAC name is 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenyl-7H-purin-9-ium-8-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenyl-7H-purin-9-ium-8-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 59439659 |
| Molecular Formula | C36H22N7S+ |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-(9-phenyl-7H-purin-9-ium-8-yl)phenyl]-1,3-benzothiazole |
| SMILES | c1ccc(-[n+]2c(-c3cc(-c4nc5ccccc5s4)cc(-c4cc5cccnc5c5ncccc45)c3)[nH]c3cncnc32)cc1 |
| InChI | InChI=1S/C36H21N7S/c1-2-9-26(10-3-1)43-34(41-30-20-37-21-40-35(30)43)24-16-23(17-25(18-24)36-42-29-12-4-5-13-31(29)44-36)28-19-22-8-6-14-38-32(22)33-27(28)11-7-15-39-33/h1-21H/p+1 |
| InChIKey | VMZJXBKLNJHDFR-UHFFFAOYSA-O |
| XLogP | 7.94 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|