C46H27F3N6S — CID 59439662
2-[3-(1,10-phenanthrolin-5-yl)-5-[3-[4-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]phenyl]-1,3-benzothiazole (PubChem CID 59439662) has the molecular formula C46H27F3N6S and a molecular weight of 752.83 g/mol. Its IUPAC name is 2-[3-(1,10-phenanthrolin-5-yl)-5-[3-[4-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-[3-[4-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 59439662 |
| Molecular Formula | C46H27F3N6S |
| Molecular Weight | 752.83 g/mol |
| Exact Mass | 752.20 |
| IUPAC Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-[3-[4-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]phenyl]-1,3-benzothiazole |
| SMILES | FC(F)(F)c1ccc(-c2nnc(-c3cccc(-c4cc(-c5nc6ccccc6s5)cc(-c5cc6cccnc6c6ncccc56)c4)c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H27F3N6S/c47-46(48,49)35-19-17-28(18-20-35)43-53-54-44(55(43)36-12-2-1-3-13-36)31-10-6-9-29(23-31)32-24-33(26-34(25-32)45-52-39-15-4-5-16-40(39)56-45)38-27-30-11-7-21-50-41(30)42-37(38)14-8-22-51-42/h1-27H |
| InChIKey | XQVCFLMZQKBXNI-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.83 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|