C33H19N5S — CID 59439664
2-[6-(1,10-phenanthrolin-4-yl)-4-quinolin-4-yl-2-pyridinyl]-1,3-benzothiazole (PubChem CID 59439664) has the molecular formula C33H19N5S and a molecular weight of 517.62 g/mol. Its IUPAC name is 2-[6-(1,10-phenanthrolin-4-yl)-4-quinolin-4-yl-2-pyridinyl]-1,3-benzothiazole.
| Compound Name | 2-[6-(1,10-phenanthrolin-4-yl)-4-quinolin-4-yl-2-pyridinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 59439664 |
| Molecular Formula | C33H19N5S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2-[6-(1,10-phenanthrolin-4-yl)-4-quinolin-4-yl-2-pyridinyl]-1,3-benzothiazole |
| SMILES | c1cnc2c(c1)ccc1c(-c3cc(-c4ccnc5ccccc45)cc(-c4nc5ccccc5s4)n3)ccnc12 |
| InChI | InChI=1S/C33H19N5S/c1-2-8-26-23(7-1)22(13-16-34-26)21-18-28(37-29(19-21)33-38-27-9-3-4-10-30(27)39-33)24-14-17-36-32-25(24)12-11-20-6-5-15-35-31(20)32/h1-19H |
| InChIKey | OIOOWGUJOHYAIV-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|