C31H33N3 — CID 59439795
2,4-bis(4-tert-butylphenyl)-6-(4-ethenylphenyl)-1,3,5-triazine (PubChem CID 59439795) has the molecular formula C31H33N3 and a molecular weight of 447.63 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-(4-ethenylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-(4-ethenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59439795 |
| Molecular Formula | C31H33N3 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-(4-ethenylphenyl)-1,3,5-triazine |
| SMILES | C=Cc1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C31H33N3/c1-8-21-9-11-22(12-10-21)27-32-28(23-13-17-25(18-14-23)30(2,3)4)34-29(33-27)24-15-19-26(20-16-24)31(5,6)7/h8-20H,1H2,2-7H3 |
| InChIKey | KROJQTQKPYAXHF-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |