C10H10N2O4 — CID 59440122
methyl (2S)-6-nitro-2,3-dihydro-1H-indole-2-carboxylate (PubChem CID 59440122) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is methyl (2S)-6-nitro-2,3-dihydro-1H-indole-2-carboxylate.
| Compound Name | methyl (2S)-6-nitro-2,3-dihydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 59440122 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | methyl (2S)-6-nitro-2,3-dihydro-1H-indole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2ccc([N+](=O)[O-])cc2N1 |
| InChI | InChI=1S/C10H10N2O4/c1-16-10(13)9-4-6-2-3-7(12(14)15)5-8(6)11-9/h2-3,5,9,11H,4H2,1H3/t9-/m0/s1 |
| InChIKey | PEFQAKIOILEYAZ-VIFPVBQESA-N |
| XLogP | 1.10 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|