C17H34S — CID 59440411
2,4,5,5-tetramethyl-6-methylidene-2-methylsulfanyl-4-propyloctane (PubChem CID 59440411) has the molecular formula C17H34S and a molecular weight of 270.53 g/mol. Its IUPAC name is 2,4,5,5-tetramethyl-6-methylidene-2-methylsulfanyl-4-propyloctane.
| Compound Name | 2,4,5,5-tetramethyl-6-methylidene-2-methylsulfanyl-4-propyloctane |
|---|---|
| PubChem CID | 59440411 |
| Molecular Formula | C17H34S |
| Molecular Weight | 270.53 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 2,4,5,5-tetramethyl-6-methylidene-2-methylsulfanyl-4-propyloctane |
| SMILES | C=C(CC)C(C)(C)C(C)(CCC)CC(C)(C)SC |
| InChI | InChI=1S/C17H34S/c1-10-12-17(8,13-15(4,5)18-9)16(6,7)14(3)11-2/h3,10-13H2,1-2,4-9H3 |
| InChIKey | APVMQQVONZQMLG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|