C21H27O5S- — CID 59440584
(3-phenyl-1-adamantyl)methyl 2-methyl-2-oxidoperoxysulfanylpropanoate (PubChem CID 59440584) has the molecular formula C21H27O5S- and a molecular weight of 391.51 g/mol. Its IUPAC name is (3-phenyl-1-adamantyl)methyl 2-methyl-2-oxidoperoxysulfanylpropanoate.
| Compound Name | (3-phenyl-1-adamantyl)methyl 2-methyl-2-oxidoperoxysulfanylpropanoate |
|---|---|
| PubChem CID | 59440584 |
| Molecular Formula | C21H27O5S- |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (3-phenyl-1-adamantyl)methyl 2-methyl-2-oxidoperoxysulfanylpropanoate |
| SMILES | CC(C)(SOO[O-])C(=O)OCC12CC3CC(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C21H28O5S/c1-19(2,27-26-25-23)18(22)24-14-20-9-15-8-16(10-20)12-21(11-15,13-20)17-6-4-3-5-7-17/h3-7,15-16,23H,8-14H2,1-2H3/p-1 |
| InChIKey | IHAIQSSBVPTMIE-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|