C23H26N6O2S — CID 59440882
4-amino-6-[4-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclohexyl]phenyl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one (PubChem CID 59440882) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is 4-amino-6-[4-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclohexyl]phenyl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one.
| Compound Name | 4-amino-6-[4-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclohexyl]phenyl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 59440882 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-amino-6-[4-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclohexyl]phenyl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one |
| SMILES | Cc1nnc(CC2CCC(c3ccc(N4CCOc5ncnc(N)c5C4=O)cc3)CC2)s1 |
| InChI | InChI=1S/C23H26N6O2S/c1-14-27-28-19(32-14)12-15-2-4-16(5-3-15)17-6-8-18(9-7-17)29-10-11-31-22-20(23(29)30)21(24)25-13-26-22/h6-9,13,15-16H,2-5,10-12H2,1H3,(H2,24,25,26) |
| InChIKey | JUVZHZMVMIRCDO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |