C28H27F2N7O3 — CID 59441845
17-[[1-[2-(dimethylamino)acetyl]-6-methoxy-3,4-dihydro-2H-quinolin-7-yl]amino]-4,5-difluoro-14-methyl-1,9,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12,16-heptaen-2-one (PubChem CID 59441845) has the molecular formula C28H27F2N7O3 and a molecular weight of 547.57 g/mol. Its IUPAC name is 17-[[1-[2-(dimethylamino)acetyl]-6-methoxy-3,4-dihydro-2H-quinolin-7-yl]amino]-4,5-difluoro-14-methyl-1,9,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12,16-heptaen-2-one.
| Compound Name | 17-[[1-[2-(dimethylamino)acetyl]-6-methoxy-3,4-dihydro-2H-quinolin-7-yl]amino]-4,5-difluoro-14-methyl-1,9,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12,16-heptaen-2-one |
|---|---|
| PubChem CID | 59441845 |
| Molecular Formula | C28H27F2N7O3 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 17-[[1-[2-(dimethylamino)acetyl]-6-methoxy-3,4-dihydro-2H-quinolin-7-yl]amino]-4,5-difluoro-14-methyl-1,9,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12,16-heptaen-2-one |
| SMILES | COc1cc2c(cc1Nc1nc3c(ccn3C)c3nc4ccc(F)c(F)c4c(=O)n13)N(C(=O)CN(C)C)CCC2 |
| InChI | InChI=1S/C28H27F2N7O3/c1-34(2)14-22(38)36-10-5-6-15-12-21(40-4)19(13-20(15)36)32-28-33-25-16(9-11-35(25)3)26-31-18-8-7-17(29)24(30)23(18)27(39)37(26)28/h7-9,11-13H,5-6,10,14H2,1-4H3,(H,32,33) |
| InChIKey | RJXPFESBBSGHBH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|