About 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine
3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 59442788) has the molecular formula C19H25Cl2N5
and a molecular weight of 394.35 g/mol. Its IUPAC name is 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 59442788 |
| Molecular Formula | C19H25Cl2N5 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCN1CCN(c2ccc(-c3ccc(Cl)c(Cl)c3)nn2)CC1 |
| InChI | InChI=1S/C19H25Cl2N5/c1-24(2)8-3-9-25-10-12-26(13-11-25)19-7-6-18(22-23-19)15-4-5-16(20)17(21)14-15/h4-7,14H,3,8-13H2,1-2H3 |
| InChIKey | DRSXSYOEXSYYCT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine (CID 59442788) is 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine is CN(C)CCCN1CCN(c2ccc(-c3ccc(Cl)c(Cl)c3)nn2)CC1.
What is the InChIKey of 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine?
The InChIKey is DRSXSYOEXSYYCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25Cl2N5/c1-24(2)8-3-9-25-10-12-26(13-11-25)19-7-6-18(22-23-19)15-4-5-16(20)17(21)14-15/h4-7,14H,3,8-13H2,1-2H3.
What are the key properties of 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine?
3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine has a molecular weight of 394.35 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[6-(3,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 59442788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).