About 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole
1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole (PubChem CID 59443012) has the molecular formula C12H11ClFN
and a molecular weight of 223.68 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole |
| PubChem CID | 59443012 |
| Molecular Formula | C12H11ClFN |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C12H11ClFN/c1-8-3-4-9(2)15(8)12-6-10(13)5-11(14)7-12/h3-7H,1-2H3 |
| InChIKey | HXTHNNYESNZCRX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole?
The IUPAC name of 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole (CID 59443012) is 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole.
What is the SMILES notation for 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole?
The canonical SMILES for 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole is Cc1ccc(C)n1-c1cc(F)cc(Cl)c1.
What is the InChIKey of 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole?
The InChIKey is HXTHNNYESNZCRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClFN/c1-8-3-4-9(2)15(8)12-6-10(13)5-11(14)7-12/h3-7H,1-2H3.
What are the key properties of 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole?
1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole has a molecular weight of 223.68 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-5-fluorophenyl)-2,5-dimethylpyrrole is sourced from PubChem (CID 59443012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).