C26H18Cl4N2O2 — CID 594431
1,5-bis[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,6-diol (PubChem CID 594431) has the molecular formula C26H18Cl4N2O2 and a molecular weight of 532.25 g/mol. Its IUPAC name is 1,5-bis[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,6-diol.
| Compound Name | 1,5-bis[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,6-diol |
|---|---|
| PubChem CID | 594431 |
| Molecular Formula | C26H18Cl4N2O2 |
| Molecular Weight | 532.25 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 1,5-bis[(2,4-dichlorophenyl)methyliminomethyl]naphthalene-2,6-diol |
| SMILES | Oc1ccc2c(/C=N/Cc3ccc(Cl)cc3Cl)c(O)ccc2c1/C=N/Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H18Cl4N2O2/c27-17-3-1-15(23(29)9-17)11-31-13-21-19-5-8-26(34)22(20(19)6-7-25(21)33)14-32-12-16-2-4-18(28)10-24(16)30/h1-10,13-14,33-34H,11-12H2/b31-13+,32-14+ |
| InChIKey | FHXSRRQDVQNTHH-GCFMLEDASA-N |
| XLogP | 8.10 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.25 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|