About 2,6-difluoro-N,N-dimethylpyrimidin-4-amine
2,6-difluoro-N,N-dimethylpyrimidin-4-amine (PubChem CID 594436) has the molecular formula C6H7F2N3
and a molecular weight of 159.14 g/mol. Its IUPAC name is 2,6-difluoro-N,N-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2,6-difluoro-N,N-dimethylpyrimidin-4-amine |
| PubChem CID | 594436 |
| Molecular Formula | C6H7F2N3 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 2,6-difluoro-N,N-dimethylpyrimidin-4-amine |
| SMILES | CN(C)c1cc(F)nc(F)n1 |
| InChI | InChI=1S/C6H7F2N3/c1-11(2)5-3-4(7)9-6(8)10-5/h3H,1-2H3 |
| InChIKey | WJTITHKMCYOWDZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-difluoro-N,N-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-N,N-dimethylpyrimidin-4-amine?
The IUPAC name of 2,6-difluoro-N,N-dimethylpyrimidin-4-amine (CID 594436) is 2,6-difluoro-N,N-dimethylpyrimidin-4-amine.
What is the SMILES notation for 2,6-difluoro-N,N-dimethylpyrimidin-4-amine?
The canonical SMILES for 2,6-difluoro-N,N-dimethylpyrimidin-4-amine is CN(C)c1cc(F)nc(F)n1.
What is the InChIKey of 2,6-difluoro-N,N-dimethylpyrimidin-4-amine?
The InChIKey is WJTITHKMCYOWDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F2N3/c1-11(2)5-3-4(7)9-6(8)10-5/h3H,1-2H3.
What are the key properties of 2,6-difluoro-N,N-dimethylpyrimidin-4-amine?
2,6-difluoro-N,N-dimethylpyrimidin-4-amine has a molecular weight of 159.14 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-N,N-dimethylpyrimidin-4-amine is sourced from PubChem (CID 594436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).