C20H23N5O4S2 — CID 59443614
1-[2-[[5-(2-hydroxyethylsulfanyl)-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443614) has the molecular formula C20H23N5O4S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 1-[2-[[5-(2-hydroxyethylsulfanyl)-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-(2-hydroxyethylsulfanyl)-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443614 |
| Molecular Formula | C20H23N5O4S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-[2-[[5-(2-hydroxyethylsulfanyl)-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | OCCSc1cnc(Nc2nc(C(O)CO)cs2)c(OC2CCCc3ncncc32)c1 |
| InChI | InChI=1S/C20H23N5O4S2/c26-4-5-30-12-6-18(29-17-3-1-2-14-13(17)8-21-11-23-14)19(22-7-12)25-20-24-15(10-31-20)16(28)9-27/h6-8,10-11,16-17,26-28H,1-5,9H2,(H,22,24,25) |
| InChIKey | BFQFASUZOZRDRS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |