C24H23N5O3S2 — CID 59443638
1-[2-[[5-phenylsulfanyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443638) has the molecular formula C24H23N5O3S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 1-[2-[[5-phenylsulfanyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-phenylsulfanyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443638 |
| Molecular Formula | C24H23N5O3S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 1-[2-[[5-phenylsulfanyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1csc(Nc2ncc(Sc3ccccc3)cc2OC2CCCc3ncncc32)n1 |
| InChI | InChI=1S/C24H23N5O3S2/c30-12-20(31)19-13-33-24(28-19)29-23-22(9-16(10-26-23)34-15-5-2-1-3-6-15)32-21-8-4-7-18-17(21)11-25-14-27-18/h1-3,5-6,9-11,13-14,20-21,30-31H,4,7-8,12H2,(H,26,28,29) |
| InChIKey | CTHLCLWDJPKKRY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |