C25H25N5O3S2 — CID 59443675
1-[2-[[5-(pyridin-2-ylmethylsulfanyl)-3-(5,6,7,8-tetrahydroquinolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443675) has the molecular formula C25H25N5O3S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 1-[2-[[5-(pyridin-2-ylmethylsulfanyl)-3-(5,6,7,8-tetrahydroquinolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-(pyridin-2-ylmethylsulfanyl)-3-(5,6,7,8-tetrahydroquinolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443675 |
| Molecular Formula | C25H25N5O3S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 1-[2-[[5-(pyridin-2-ylmethylsulfanyl)-3-(5,6,7,8-tetrahydroquinolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1csc(Nc2ncc(SCc3ccccn3)cc2OC2CCCc3ncccc32)n1 |
| InChI | InChI=1S/C25H25N5O3S2/c31-13-21(32)20-15-35-25(29-20)30-24-23(33-22-8-3-7-19-18(22)6-4-10-27-19)11-17(12-28-24)34-14-16-5-1-2-9-26-16/h1-2,4-6,9-12,15,21-22,31-32H,3,7-8,13-14H2,(H,28,29,30) |
| InChIKey | UKZQGWQCWRKSHR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |