C20H19F3N4O3S — CID 59443681
1-[2-[[3-(5,6,7,8-tetrahydroisoquinolin-8-yloxy)-5-(trifluoromethyl)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443681) has the molecular formula C20H19F3N4O3S and a molecular weight of 452.46 g/mol. Its IUPAC name is 1-[2-[[3-(5,6,7,8-tetrahydroisoquinolin-8-yloxy)-5-(trifluoromethyl)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[3-(5,6,7,8-tetrahydroisoquinolin-8-yloxy)-5-(trifluoromethyl)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443681 |
| Molecular Formula | C20H19F3N4O3S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[2-[[3-(5,6,7,8-tetrahydroisoquinolin-8-yloxy)-5-(trifluoromethyl)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1csc(Nc2ncc(C(F)(F)F)cc2OC2CCCc3ccncc32)n1 |
| InChI | InChI=1S/C20H19F3N4O3S/c21-20(22,23)12-6-17(30-16-3-1-2-11-4-5-24-8-13(11)16)18(25-7-12)27-19-26-14(10-31-19)15(29)9-28/h4-8,10,15-16,28-29H,1-3,9H2,(H,25,26,27) |
| InChIKey | JMQBBJPGNKKXHH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |