C18H18N6O4S2 — CID 59443693
1-[2-[[5-(2-hydroxyethylsulfanyl)-3-([1,2,4]triazolo[4,3-a]pyridin-7-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443693) has the molecular formula C18H18N6O4S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-[2-[[5-(2-hydroxyethylsulfanyl)-3-([1,2,4]triazolo[4,3-a]pyridin-7-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-(2-hydroxyethylsulfanyl)-3-([1,2,4]triazolo[4,3-a]pyridin-7-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443693 |
| Molecular Formula | C18H18N6O4S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 1-[2-[[5-(2-hydroxyethylsulfanyl)-3-([1,2,4]triazolo[4,3-a]pyridin-7-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | OCCSc1cnc(Nc2nc(C(O)CO)cs2)c(Oc2ccn3cnnc3c2)c1 |
| InChI | InChI=1S/C18H18N6O4S2/c25-3-4-29-12-6-15(28-11-1-2-24-10-20-23-16(24)5-11)17(19-7-12)22-18-21-13(9-30-18)14(27)8-26/h1-2,5-7,9-10,14,25-27H,3-4,8H2,(H,19,21,22) |
| InChIKey | PPMRKCBJECWMTR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |