C24H24N6O3S2 — CID 59443714
1-[2-[[5-[(2-methyl-3-pyridinyl)sulfanyl]-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443714) has the molecular formula C24H24N6O3S2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 1-[2-[[5-[(2-methyl-3-pyridinyl)sulfanyl]-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-[(2-methyl-3-pyridinyl)sulfanyl]-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443714 |
| Molecular Formula | C24H24N6O3S2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 1-[2-[[5-[(2-methyl-3-pyridinyl)sulfanyl]-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | Cc1ncccc1Sc1cnc(Nc2nc(C(O)CO)cs2)c(OC2CCCc3ncncc32)c1 |
| InChI | InChI=1S/C24H24N6O3S2/c1-14-22(6-3-7-26-14)35-15-8-21(33-20-5-2-4-17-16(20)10-25-13-28-17)23(27-9-15)30-24-29-18(12-34-24)19(32)11-31/h3,6-10,12-13,19-20,31-32H,2,4-5,11H2,1H3,(H,27,29,30) |
| InChIKey | HRFHSCINFUWUJE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |