C25H26N6O3S2 — CID 59443716
1-[2-[[5-(1-pyridin-2-ylethylsulfanyl)-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 59443716) has the molecular formula C25H26N6O3S2 and a molecular weight of 522.66 g/mol. Its IUPAC name is 1-[2-[[5-(1-pyridin-2-ylethylsulfanyl)-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-(1-pyridin-2-ylethylsulfanyl)-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 59443716 |
| Molecular Formula | C25H26N6O3S2 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 1-[2-[[5-(1-pyridin-2-ylethylsulfanyl)-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | CC(Sc1cnc(Nc2nc(C(O)CO)cs2)c(OC2CCCc3ncncc32)c1)c1ccccn1 |
| InChI | InChI=1S/C25H26N6O3S2/c1-15(18-5-2-3-8-27-18)36-16-9-23(34-22-7-4-6-19-17(22)11-26-14-29-19)24(28-10-16)31-25-30-20(13-35-25)21(33)12-32/h2-3,5,8-11,13-15,21-22,32-33H,4,6-7,12H2,1H3,(H,28,30,31) |
| InChIKey | MUECBYHZYSBMGK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |